C10H6Cl2FIO2 — CID 140860488
trans-(1R,3R)-2,2-dichloro-3-(4-fluoro-3-iodophenyl)cyclopropane-1-carboxylic acid (PubChem CID 140860488) has the molecular formula C10H6Cl2FIO2 and a molecular weight of 374.96 g/mol. Its IUPAC name is trans-(1R,3R)-2,2-dichloro-3-(4-fluoro-3-iodophenyl)cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,3R)-2,2-dichloro-3-(4-fluoro-3-iodophenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 140860488 |
| Molecular Formula | C10H6Cl2FIO2 |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 373.88 |
| IUPAC Name | trans-(1R,3R)-2,2-dichloro-3-(4-fluoro-3-iodophenyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@H](c2ccc(F)c(I)c2)C1(Cl)Cl |
| InChI | InChI=1S/C10H6Cl2FIO2/c11-10(12)7(8(10)9(15)16)4-1-2-5(13)6(14)3-4/h1-3,7-8H,(H,15,16)/t7-,8+/m0/s1 |
| InChIKey | OQRCEHRLXAYMGE-JGVFFNPUSA-N |
| XLogP | 3.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|