C11H8BrCl2FO3 — CID 122615375
trans-(1R,3R)-3-(4-bromo-3-fluoro-5-methoxyphenyl)-2,2-dichlorocyclopropane-1-carboxylic acid (PubChem CID 122615375) has the molecular formula C11H8BrCl2FO3 and a molecular weight of 357.99 g/mol. Its IUPAC name is trans-(1R,3R)-3-(4-bromo-3-fluoro-5-methoxyphenyl)-2,2-dichlorocyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,3R)-3-(4-bromo-3-fluoro-5-methoxyphenyl)-2,2-dichlorocyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 122615375 |
| Molecular Formula | C11H8BrCl2FO3 |
| Molecular Weight | 357.99 g/mol |
| Exact Mass | 355.90 |
| IUPAC Name | trans-(1R,3R)-3-(4-bromo-3-fluoro-5-methoxyphenyl)-2,2-dichlorocyclopropane-1-carboxylic acid |
| SMILES | COc1cc([C@H]2[C@H](C(=O)O)C2(Cl)Cl)cc(F)c1Br |
| InChI | InChI=1S/C11H8BrCl2FO3/c1-18-6-3-4(2-5(15)9(6)12)7-8(10(16)17)11(7,13)14/h2-3,7-8H,1H3,(H,16,17)/t7-,8+/m0/s1 |
| InChIKey | HGIMXBQTFJUWSI-JGVFFNPUSA-N |
| XLogP | 3.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.99 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|