C11H8Cl3FO — CID 138652527
1-[2,2-dichloro-3-(3-chloro-5-fluorophenyl)cyclopropyl]ethanone (PubChem CID 138652527) has the molecular formula C11H8Cl3FO and a molecular weight of 281.54 g/mol. Its IUPAC name is 1-[2,2-dichloro-3-(3-chloro-5-fluorophenyl)cyclopropyl]ethanone.
| Compound Name | 1-[2,2-dichloro-3-(3-chloro-5-fluorophenyl)cyclopropyl]ethanone |
|---|---|
| PubChem CID | 138652527 |
| Molecular Formula | C11H8Cl3FO |
| Molecular Weight | 281.54 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 1-[2,2-dichloro-3-(3-chloro-5-fluorophenyl)cyclopropyl]ethanone |
| SMILES | CC(=O)C1C(c2cc(F)cc(Cl)c2)C1(Cl)Cl |
| InChI | InChI=1S/C11H8Cl3FO/c1-5(16)9-10(11(9,13)14)6-2-7(12)4-8(15)3-6/h2-4,9-10H,1H3 |
| InChIKey | HYCLQHNFGPHGLY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|