C25H15Cl4F4N3O3 — CID 140859853
N-(3-acetamido-2,4-difluorophenyl)-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-2,3-difluorobenzamide (PubChem CID 140859853) has the molecular formula C25H15Cl4F4N3O3 and a molecular weight of 623.22 g/mol. Its IUPAC name is N-(3-acetamido-2,4-difluorophenyl)-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-2,3-difluorobenzamide.
| Compound Name | N-(3-acetamido-2,4-difluorophenyl)-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 140859853 |
| Molecular Formula | C25H15Cl4F4N3O3 |
| Molecular Weight | 623.22 g/mol |
| Exact Mass | 620.98 |
| IUPAC Name | N-(3-acetamido-2,4-difluorophenyl)-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-2,3-difluorobenzamide |
| SMILES | CC(=O)Nc1c(F)ccc(NC(=O)c2cc(NC(=O)[C@H]3[C@H](c4cc(Cl)cc(Cl)c4)C3(Cl)Cl)cc(F)c2F)c1F |
| InChI | InChI=1S/C25H15Cl4F4N3O3/c1-9(37)34-22-15(30)2-3-17(21(22)33)36-23(38)14-7-13(8-16(31)20(14)32)35-24(39)19-18(25(19,28)29)10-4-11(26)6-12(27)5-10/h2-8,18-19H,1H3,(H,34,37)(H,35,39)(H,36,38)/t18-,19+/m0/s1 |
| InChIKey | IESDXBIPPFTTBU-RBUKOAKNSA-N |
| XLogP | 7.29 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.22 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|