C16H11Cl4NO3S — CID 139533823
methyl 4-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]thiophene-2-carboxylate (PubChem CID 139533823) has the molecular formula C16H11Cl4NO3S and a molecular weight of 439.15 g/mol. Its IUPAC name is methyl 4-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 4-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 139533823 |
| Molecular Formula | C16H11Cl4NO3S |
| Molecular Weight | 439.15 g/mol |
| Exact Mass | 436.92 |
| IUPAC Name | methyl 4-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)cs1 |
| InChI | InChI=1S/C16H11Cl4NO3S/c1-24-15(23)11-5-10(6-25-11)21-14(22)13-12(16(13,19)20)7-2-8(17)4-9(18)3-7/h2-6,12-13H,1H3,(H,21,22) |
| InChIKey | UBXWGIQTUNIHPA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.15 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|