C19H13Cl4F3N2O2 — CID 122621464
5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-methyl-2-(trifluoromethyl)benzamide (PubChem CID 122621464) has the molecular formula C19H13Cl4F3N2O2 and a molecular weight of 500.13 g/mol. Its IUPAC name is 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-methyl-2-(trifluoromethyl)benzamide.
| Compound Name | 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-methyl-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 122621464 |
| Molecular Formula | C19H13Cl4F3N2O2 |
| Molecular Weight | 500.13 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-methyl-2-(trifluoromethyl)benzamide |
| SMILES | CNC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C19H13Cl4F3N2O2/c1-27-16(29)12-7-11(2-3-13(12)19(24,25)26)28-17(30)15-14(18(15,22)23)8-4-9(20)6-10(21)5-8/h2-7,14-15H,1H3,(H,27,29)(H,28,30) |
| InChIKey | IBPPICJUVPSGMC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.13 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|