C19H14Cl6N2O2 — CID 122622328
2,3-dichloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-ethylbenzamide (PubChem CID 122622328) has the molecular formula C19H14Cl6N2O2 and a molecular weight of 515.05 g/mol. Its IUPAC name is 2,3-dichloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-ethylbenzamide.
| Compound Name | 2,3-dichloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 122622328 |
| Molecular Formula | C19H14Cl6N2O2 |
| Molecular Weight | 515.05 g/mol |
| Exact Mass | 511.92 |
| IUPAC Name | 2,3-dichloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C19H14Cl6N2O2/c1-2-26-17(28)12-6-11(7-13(22)16(12)23)27-18(29)15-14(19(15,24)25)8-3-9(20)5-10(21)4-8/h3-7,14-15H,2H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | QVFYWICGQKHDSI-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.05 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|