C20H16Cl6N2O2 — CID 122621076
2,4-dichloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-propylbenzamide (PubChem CID 122621076) has the molecular formula C20H16Cl6N2O2 and a molecular weight of 529.08 g/mol. Its IUPAC name is 2,4-dichloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-propylbenzamide.
| Compound Name | 2,4-dichloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-propylbenzamide |
|---|---|
| PubChem CID | 122621076 |
| Molecular Formula | C20H16Cl6N2O2 |
| Molecular Weight | 529.08 g/mol |
| Exact Mass | 525.93 |
| IUPAC Name | 2,4-dichloro-5-[[(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(NC(=O)[C@H]2[C@H](c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl6N2O2/c1-2-3-27-18(29)12-7-15(14(24)8-13(12)23)28-19(30)17-16(20(17,25)26)9-4-10(21)6-11(22)5-9/h4-8,16-17H,2-3H2,1H3,(H,27,29)(H,28,30)/t16-,17+/m0/s1 |
| InChIKey | PDXLSKOZYAJOLP-DLBZAZTESA-N |
| XLogP | 6.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.08 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|