C19H15Cl6FN2O2 — CID 163659322
2,4-dichloro-5-[[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-hydroxymethyl]amino]-N-(2-fluoroethyl)benzamide (PubChem CID 163659322) has the molecular formula C19H15Cl6FN2O2 and a molecular weight of 535.06 g/mol. Its IUPAC name is 2,4-dichloro-5-[[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-hydroxymethyl]amino]-N-(2-fluoroethyl)benzamide.
| Compound Name | 2,4-dichloro-5-[[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-hydroxymethyl]amino]-N-(2-fluoroethyl)benzamide |
|---|---|
| PubChem CID | 163659322 |
| Molecular Formula | C19H15Cl6FN2O2 |
| Molecular Weight | 535.06 g/mol |
| Exact Mass | 531.92 |
| IUPAC Name | 2,4-dichloro-5-[[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropyl]-hydroxymethyl]amino]-N-(2-fluoroethyl)benzamide |
| SMILES | O=C(NCCF)c1cc(NC(O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl6FN2O2/c20-9-3-8(4-10(21)5-9)15-16(19(15,24)25)18(30)28-14-6-11(12(22)7-13(14)23)17(29)27-2-1-26/h3-7,15-16,18,28,30H,1-2H2,(H,27,29) |
| InChIKey | ITAAJKUFZUVQEX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.06 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|