C9H9ClFNOS — CID 130505013
2-chloro-N-(2-fluoroethyl)-5-sulfanylbenzamide (PubChem CID 130505013) has the molecular formula C9H9ClFNOS and a molecular weight of 233.69 g/mol. Its IUPAC name is 2-chloro-N-(2-fluoroethyl)-5-sulfanylbenzamide.
| Compound Name | 2-chloro-N-(2-fluoroethyl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 130505013 |
| Molecular Formula | C9H9ClFNOS |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 2-chloro-N-(2-fluoroethyl)-5-sulfanylbenzamide |
| SMILES | O=C(NCCF)c1cc(S)ccc1Cl |
| InChI | InChI=1S/C9H9ClFNOS/c10-8-2-1-6(14)5-7(8)9(13)12-4-3-11/h1-2,5,14H,3-4H2,(H,12,13) |
| InChIKey | KCXQBRNOLFAKPO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|