C10H11ClN2O3S — CID 107034131
2-[(2-chloro-5-sulfanylbenzoyl)amino]ethyl carbamate (PubChem CID 107034131) has the molecular formula C10H11ClN2O3S and a molecular weight of 274.73 g/mol. Its IUPAC name is 2-[(2-chloro-5-sulfanylbenzoyl)amino]ethyl carbamate.
| Compound Name | 2-[(2-chloro-5-sulfanylbenzoyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 107034131 |
| Molecular Formula | C10H11ClN2O3S |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-[(2-chloro-5-sulfanylbenzoyl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)c1cc(S)ccc1Cl |
| InChI | InChI=1S/C10H11ClN2O3S/c11-8-2-1-6(17)5-7(8)9(14)13-3-4-16-10(12)15/h1-2,5,17H,3-4H2,(H2,12,15)(H,13,14) |
| InChIKey | JFFVCIISSIFVMY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|