C9H7ClF3NOS — CID 107021740
2-chloro-5-sulfanyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 107021740) has the molecular formula C9H7ClF3NOS and a molecular weight of 269.68 g/mol. Its IUPAC name is 2-chloro-5-sulfanyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-chloro-5-sulfanyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 107021740 |
| Molecular Formula | C9H7ClF3NOS |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 2-chloro-5-sulfanyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1cc(S)ccc1Cl |
| InChI | InChI=1S/C9H7ClF3NOS/c10-7-2-1-5(16)3-6(7)8(15)14-4-9(11,12)13/h1-3,16H,4H2,(H,14,15) |
| InChIKey | ZFUVNMTZZCLQOP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|