C8H5Cl2F3N2O — CID 114917186
2,5-dichloro-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide (PubChem CID 114917186) has the molecular formula C8H5Cl2F3N2O and a molecular weight of 273.04 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114917186 |
| Molecular Formula | C8H5Cl2F3N2O |
| Molecular Weight | 273.04 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 2,5-dichloro-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C8H5Cl2F3N2O/c9-5-2-14-6(10)1-4(5)7(16)15-3-8(11,12)13/h1-2H,3H2,(H,15,16) |
| InChIKey | FBQWYDBDEZGZMM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.04 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|