C14H20Cl2N2O — CID 114917844
2,5-dichloro-N-(2,4,4-trimethylpentan-2-yl)pyridine-4-carboxamide (PubChem CID 114917844) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,4,4-trimethylpentan-2-yl)pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-(2,4,4-trimethylpentan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114917844 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2,5-dichloro-N-(2,4,4-trimethylpentan-2-yl)pyridine-4-carboxamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C14H20Cl2N2O/c1-13(2,3)8-14(4,5)18-12(19)9-6-11(16)17-7-10(9)15/h6-7H,8H2,1-5H3,(H,18,19) |
| InChIKey | DTOYVOZPTXTROJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|