C17H25BrClNO3 — CID 139391047
5-bromo-4-chloro-2-(methoxymethoxy)-N-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 139391047) has the molecular formula C17H25BrClNO3 and a molecular weight of 406.75 g/mol. Its IUPAC name is 5-bromo-4-chloro-2-(methoxymethoxy)-N-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | 5-bromo-4-chloro-2-(methoxymethoxy)-N-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 139391047 |
| Molecular Formula | C17H25BrClNO3 |
| Molecular Weight | 406.75 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 5-bromo-4-chloro-2-(methoxymethoxy)-N-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | COCOc1cc(Cl)c(Br)cc1C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C17H25BrClNO3/c1-16(2,3)9-17(4,5)20-15(21)11-7-12(18)13(19)8-14(11)23-10-22-6/h7-8H,9-10H2,1-6H3,(H,20,21) |
| InChIKey | GYYUUPFNTPQQOJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.75 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|