C22H38BrNO4Si — CID 156624517
5-bromo-3,4-dimethoxy-N-(2,4,4-trimethylpentan-2-yl)-2-(2-trimethylsilylethoxy)benzamide (PubChem CID 156624517) has the molecular formula C22H38BrNO4Si and a molecular weight of 488.54 g/mol. Its IUPAC name is 5-bromo-3,4-dimethoxy-N-(2,4,4-trimethylpentan-2-yl)-2-(2-trimethylsilylethoxy)benzamide.
| Compound Name | 5-bromo-3,4-dimethoxy-N-(2,4,4-trimethylpentan-2-yl)-2-(2-trimethylsilylethoxy)benzamide |
|---|---|
| PubChem CID | 156624517 |
| Molecular Formula | C22H38BrNO4Si |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 5-bromo-3,4-dimethoxy-N-(2,4,4-trimethylpentan-2-yl)-2-(2-trimethylsilylethoxy)benzamide |
| SMILES | COc1c(Br)cc(C(=O)NC(C)(C)CC(C)(C)C)c(OCC[Si](C)(C)C)c1OC |
| InChI | InChI=1S/C22H38BrNO4Si/c1-21(2,3)14-22(4,5)24-20(25)15-13-16(23)18(26-6)19(27-7)17(15)28-11-12-29(8,9)10/h13H,11-12,14H2,1-10H3,(H,24,25) |
| InChIKey | ZTGPWBULQSXFAG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|