C25H42BNO6S — CID 174116304
3,4-dimethoxy-2-(2-sulfanylethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 174116304) has the molecular formula C25H42BNO6S and a molecular weight of 495.49 g/mol. Its IUPAC name is 3,4-dimethoxy-2-(2-sulfanylethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | 3,4-dimethoxy-2-(2-sulfanylethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 174116304 |
| Molecular Formula | C25H42BNO6S |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 3,4-dimethoxy-2-(2-sulfanylethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | COc1c(B2OC(C)(C)C(C)(C)O2)cc(C(=O)NC(C)(C)CC(C)(C)C)c(OCCS)c1OC |
| InChI | InChI=1S/C25H42BNO6S/c1-22(2,3)15-23(4,5)27-21(28)16-14-17(26-32-24(6,7)25(8,9)33-26)19(29-10)20(30-11)18(16)31-12-13-34/h14,34H,12-13,15H2,1-11H3,(H,27,28) |
| InChIKey | CRMLEPYCLSWMIB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|