C28H47BNO6Si — CID 155630711
CID 155630711 (PubChem CID 155630711) has the molecular formula C28H47BNO6Si and a molecular weight of 532.58 g/mol.
| Compound Name | CID 155630711 |
|---|---|
| PubChem CID | 155630711 |
| Molecular Formula | C28H47BNO6Si |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | — |
| SMILES | C[Si](C)CCCOc1c(C(=O)NC(C)(C)CC(C)(C)C)cc(B2OC(C)(C)C(C)(C)O2)c2c1OCCO2 |
| InChI | InChI=1S/C28H47BNO6Si/c1-25(2,3)18-26(4,5)30-24(31)19-17-20(29-35-27(6,7)28(8,9)36-29)22-23(34-15-14-33-22)21(19)32-13-12-16-37(10)11/h17H,12-16,18H2,1-11H3,(H,30,31) |
| InChIKey | SCBPDXJGMBHSJR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|