C26H45BFNO4S — CID 174116296
3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[2-(trimethyl-λ4-sulfanyl)ethoxy]-N-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 174116296) has the molecular formula C26H45BFNO4S and a molecular weight of 497.53 g/mol. Its IUPAC name is 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[2-(trimethyl-λ4-sulfanyl)ethoxy]-N-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[2-(trimethyl-λ4-sulfanyl)ethoxy]-N-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 174116296 |
| Molecular Formula | C26H45BFNO4S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[2-(trimethyl-λ4-sulfanyl)ethoxy]-N-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)cc(F)c1OCCS(C)(C)C |
| InChI | InChI=1S/C26H45BFNO4S/c1-23(2,3)17-24(4,5)29-22(30)19-15-18(27-32-25(6,7)26(8,9)33-27)16-20(28)21(19)31-13-14-34(10,11)12/h15-16H,13-14,17H2,1-12H3,(H,29,30) |
| InChIKey | OPIYMNOJYAICRC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|