C23H32BF2NO5 — CID 66837541
tert-butyl 6-[[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 66837541) has the molecular formula C23H32BF2NO5 and a molecular weight of 451.32 g/mol. Its IUPAC name is tert-butyl 6-[[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl 6-[[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 66837541 |
| Molecular Formula | C23H32BF2NO5 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | tert-butyl 6-[[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2C(COc3c(F)cc(B4OC(C)(C)C(C)(C)O4)cc3F)C2C1 |
| InChI | InChI=1S/C23H32BF2NO5/c1-21(2,3)30-20(28)27-10-14-15(11-27)16(14)12-29-19-17(25)8-13(9-18(19)26)24-31-22(4,5)23(6,7)32-24/h8-9,14-16H,10-12H2,1-7H3 |
| InChIKey | ATJLGDSIWRASQV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|