C24H35BF3NO5 — CID 164687641
tert-butyl 3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenoxy]methyl]piperidine-1-carboxylate (PubChem CID 164687641) has the molecular formula C24H35BF3NO5 and a molecular weight of 485.35 g/mol. Its IUPAC name is tert-butyl 3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenoxy]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164687641 |
| Molecular Formula | C24H35BF3NO5 |
| Molecular Weight | 485.35 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | tert-butyl 3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenoxy]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(COc2cc(B3OC(C)(C)C(C)(C)O3)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C24H35BF3NO5/c1-21(2,3)32-20(30)29-10-8-9-16(14-29)15-31-19-12-17(24(26,27)28)11-18(13-19)25-33-22(4,5)23(6,7)34-25/h11-13,16H,8-10,14-15H2,1-7H3 |
| InChIKey | WALAXXYWJCNCFL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|