C22H39NO4Si — CID 156624508
3,4-dimethoxy-N-(2,4,4-trimethylpentan-2-yl)-2-(2-trimethylsilylethoxy)benzamide (PubChem CID 156624508) has the molecular formula C22H39NO4Si and a molecular weight of 409.64 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(2,4,4-trimethylpentan-2-yl)-2-(2-trimethylsilylethoxy)benzamide.
| Compound Name | 3,4-dimethoxy-N-(2,4,4-trimethylpentan-2-yl)-2-(2-trimethylsilylethoxy)benzamide |
|---|---|
| PubChem CID | 156624508 |
| Molecular Formula | C22H39NO4Si |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 3,4-dimethoxy-N-(2,4,4-trimethylpentan-2-yl)-2-(2-trimethylsilylethoxy)benzamide |
| SMILES | COc1ccc(C(=O)NC(C)(C)CC(C)(C)C)c(OCC[Si](C)(C)C)c1OC |
| InChI | InChI=1S/C22H39NO4Si/c1-21(2,3)15-22(4,5)23-20(24)16-11-12-17(25-6)19(26-7)18(16)27-13-14-28(8,9)10/h11-12H,13-15H2,1-10H3,(H,23,24) |
| InChIKey | IQMYQKZRXDASFV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|