C20H23NO6 — CID 120700996
2-methyl-2-phenyl-3-[(2,3,4-trimethoxybenzoyl)amino]propanoic acid (PubChem CID 120700996) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-methyl-2-phenyl-3-[(2,3,4-trimethoxybenzoyl)amino]propanoic acid.
| Compound Name | 2-methyl-2-phenyl-3-[(2,3,4-trimethoxybenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 120700996 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-methyl-2-phenyl-3-[(2,3,4-trimethoxybenzoyl)amino]propanoic acid |
| SMILES | COc1ccc(C(=O)NCC(C)(C(=O)O)c2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C20H23NO6/c1-20(19(23)24,13-8-6-5-7-9-13)12-21-18(22)14-10-11-15(25-2)17(27-4)16(14)26-3/h5-11H,12H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | LLECIYJYYSGEIG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |