C9H8ClF3N2O2 — CID 172609966
6-chloro-4-methoxy-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 172609966) has the molecular formula C9H8ClF3N2O2 and a molecular weight of 268.62 g/mol. Its IUPAC name is 6-chloro-4-methoxy-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-4-methoxy-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172609966 |
| Molecular Formula | C9H8ClF3N2O2 |
| Molecular Weight | 268.62 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 6-chloro-4-methoxy-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | COc1cc(Cl)ncc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H8ClF3N2O2/c1-17-6-2-7(10)14-3-5(6)8(16)15-4-9(11,12)13/h2-3H,4H2,1H3,(H,15,16) |
| InChIKey | PBIALLGJHPJVDM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.62 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|