C14H20ClF2N3O2 — CID 90134494
6-chloro-N-(2,2-difluoro-3-hydroxy-3-methylbutyl)-4-(propan-2-ylamino)pyridine-3-carboxamide (PubChem CID 90134494) has the molecular formula C14H20ClF2N3O2 and a molecular weight of 335.78 g/mol. Its IUPAC name is 6-chloro-N-(2,2-difluoro-3-hydroxy-3-methylbutyl)-4-(propan-2-ylamino)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(2,2-difluoro-3-hydroxy-3-methylbutyl)-4-(propan-2-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90134494 |
| Molecular Formula | C14H20ClF2N3O2 |
| Molecular Weight | 335.78 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 6-chloro-N-(2,2-difluoro-3-hydroxy-3-methylbutyl)-4-(propan-2-ylamino)pyridine-3-carboxamide |
| SMILES | CC(C)Nc1cc(Cl)ncc1C(=O)NCC(F)(F)C(C)(C)O |
| InChI | InChI=1S/C14H20ClF2N3O2/c1-8(2)20-10-5-11(15)18-6-9(10)12(21)19-7-14(16,17)13(3,4)22/h5-6,8,22H,7H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | ZHILEFSSVLWZTG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.78 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|