C15H19ClF3N3O3 — CID 139508071
6-chloro-4-[(4,4-difluorooxolan-3-yl)amino]-N-[(2R)-2-fluoro-3-hydroxy-3-methylbutyl]pyridine-3-carboxamide (PubChem CID 139508071) has the molecular formula C15H19ClF3N3O3 and a molecular weight of 381.78 g/mol. Its IUPAC name is 6-chloro-4-[(4,4-difluorooxolan-3-yl)amino]-N-[(2R)-2-fluoro-3-hydroxy-3-methylbutyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[(4,4-difluorooxolan-3-yl)amino]-N-[(2R)-2-fluoro-3-hydroxy-3-methylbutyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139508071 |
| Molecular Formula | C15H19ClF3N3O3 |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 6-chloro-4-[(4,4-difluorooxolan-3-yl)amino]-N-[(2R)-2-fluoro-3-hydroxy-3-methylbutyl]pyridine-3-carboxamide |
| SMILES | CC(C)(O)[C@H](F)CNC(=O)c1cnc(Cl)cc1NC1COCC1(F)F |
| InChI | InChI=1S/C15H19ClF3N3O3/c1-14(2,24)10(17)5-21-13(23)8-4-20-12(16)3-9(8)22-11-6-25-7-15(11,18)19/h3-4,10-11,24H,5-7H2,1-2H3,(H,20,22)(H,21,23)/t10-,11?/m1/s1 |
| InChIKey | KWCANDDGJPXSAV-NFJWQWPMSA-N |
| XLogP | 2.02 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|