C17H25BrFN3O2 — CID 146415703
6-bromo-4-(cyclohexylamino)-N-(2-fluoro-3-hydroxy-3-methylbutyl)pyridine-3-carboxamide (PubChem CID 146415703) has the molecular formula C17H25BrFN3O2 and a molecular weight of 402.31 g/mol. Its IUPAC name is 6-bromo-4-(cyclohexylamino)-N-(2-fluoro-3-hydroxy-3-methylbutyl)pyridine-3-carboxamide.
| Compound Name | 6-bromo-4-(cyclohexylamino)-N-(2-fluoro-3-hydroxy-3-methylbutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146415703 |
| Molecular Formula | C17H25BrFN3O2 |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 6-bromo-4-(cyclohexylamino)-N-(2-fluoro-3-hydroxy-3-methylbutyl)pyridine-3-carboxamide |
| SMILES | CC(C)(O)C(F)CNC(=O)c1cnc(Br)cc1NC1CCCCC1 |
| InChI | InChI=1S/C17H25BrFN3O2/c1-17(2,24)14(19)10-21-16(23)12-9-20-15(18)8-13(12)22-11-6-4-3-5-7-11/h8-9,11,14,24H,3-7,10H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | AMABGTGEZQOCDR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|