C21H29ClFN5O2 — CID 146381870
6-chloro-N-(2-fluoro-3-hydroxy-3-methylbutyl)-4-[[4-(1-methylpyrazol-4-yl)cyclohexyl]amino]pyridine-3-carboxamide (PubChem CID 146381870) has the molecular formula C21H29ClFN5O2 and a molecular weight of 437.95 g/mol. Its IUPAC name is 6-chloro-N-(2-fluoro-3-hydroxy-3-methylbutyl)-4-[[4-(1-methylpyrazol-4-yl)cyclohexyl]amino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(2-fluoro-3-hydroxy-3-methylbutyl)-4-[[4-(1-methylpyrazol-4-yl)cyclohexyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146381870 |
| Molecular Formula | C21H29ClFN5O2 |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 6-chloro-N-(2-fluoro-3-hydroxy-3-methylbutyl)-4-[[4-(1-methylpyrazol-4-yl)cyclohexyl]amino]pyridine-3-carboxamide |
| SMILES | Cn1cc(C2CCC(Nc3cc(Cl)ncc3C(=O)NCC(F)C(C)(C)O)CC2)cn1 |
| InChI | InChI=1S/C21H29ClFN5O2/c1-21(2,30)18(23)11-25-20(29)16-10-24-19(22)8-17(16)27-15-6-4-13(5-7-15)14-9-26-28(3)12-14/h8-10,12-13,15,18,30H,4-7,11H2,1-3H3,(H,24,27)(H,25,29) |
| InChIKey | PPCZWTFLJWTCLZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|