C18H27ClFN3O3 — CID 138704638
6-chloro-N-(2-fluoro-3-hydroxy-3-methylbutyl)-4-[[(1S)-3-hydroxy-3-methylcyclohexyl]amino]pyridine-3-carboxamide (PubChem CID 138704638) has the molecular formula C18H27ClFN3O3 and a molecular weight of 387.88 g/mol. Its IUPAC name is 6-chloro-N-(2-fluoro-3-hydroxy-3-methylbutyl)-4-[[(1S)-3-hydroxy-3-methylcyclohexyl]amino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(2-fluoro-3-hydroxy-3-methylbutyl)-4-[[(1S)-3-hydroxy-3-methylcyclohexyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138704638 |
| Molecular Formula | C18H27ClFN3O3 |
| Molecular Weight | 387.88 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 6-chloro-N-(2-fluoro-3-hydroxy-3-methylbutyl)-4-[[(1S)-3-hydroxy-3-methylcyclohexyl]amino]pyridine-3-carboxamide |
| SMILES | CC1(O)CCC[C@H](Nc2cc(Cl)ncc2C(=O)NCC(F)C(C)(C)O)C1 |
| InChI | InChI=1S/C18H27ClFN3O3/c1-17(2,25)14(20)10-22-16(24)12-9-21-15(19)7-13(12)23-11-5-4-6-18(3,26)8-11/h7,9,11,14,25-26H,4-6,8,10H2,1-3H3,(H,21,23)(H,22,24)/t11-,14?,18?/m0/s1 |
| InChIKey | AGCGTHLCPMYUHA-JCDGYTILSA-N |
| XLogP | 2.68 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.88 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|