C17H22ClN3O3 — CID 135307805
2-[[6-chloro-4-(propan-2-ylamino)pyridine-3-carbonyl]amino]spiro[3.3]heptane-6-carboxylic acid (PubChem CID 135307805) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is 2-[[6-chloro-4-(propan-2-ylamino)pyridine-3-carbonyl]amino]spiro[3.3]heptane-6-carboxylic acid.
| Compound Name | 2-[[6-chloro-4-(propan-2-ylamino)pyridine-3-carbonyl]amino]spiro[3.3]heptane-6-carboxylic acid |
|---|---|
| PubChem CID | 135307805 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-[[6-chloro-4-(propan-2-ylamino)pyridine-3-carbonyl]amino]spiro[3.3]heptane-6-carboxylic acid |
| SMILES | CC(C)Nc1cc(Cl)ncc1C(=O)NC1CC2(C1)CC(C(=O)O)C2 |
| InChI | InChI=1S/C17H22ClN3O3/c1-9(2)20-13-3-14(18)19-8-12(13)15(22)21-11-6-17(7-11)4-10(5-17)16(23)24/h3,8-11H,4-7H2,1-2H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | XOCUSQZMBKMGAB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|