C10H10Cl2N2O — CID 114918894
2,5-dichloro-N-(1-methylcyclopropyl)pyridine-4-carboxamide (PubChem CID 114918894) has the molecular formula C10H10Cl2N2O and a molecular weight of 245.11 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-methylcyclopropyl)pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-(1-methylcyclopropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114918894 |
| Molecular Formula | C10H10Cl2N2O |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 2,5-dichloro-N-(1-methylcyclopropyl)pyridine-4-carboxamide |
| SMILES | CC1(NC(=O)c2cc(Cl)ncc2Cl)CC1 |
| InChI | InChI=1S/C10H10Cl2N2O/c1-10(2-3-10)14-9(15)6-4-8(12)13-5-7(6)11/h4-5H,2-3H2,1H3,(H,14,15) |
| InChIKey | ZCHSHXQOQISBBL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|