C9H7Cl2F3N2O2 — CID 105056220
2,5-dichloro-N-(3,3,3-trifluoro-2-hydroxypropyl)pyridine-4-carboxamide (PubChem CID 105056220) has the molecular formula C9H7Cl2F3N2O2 and a molecular weight of 303.07 g/mol. Its IUPAC name is 2,5-dichloro-N-(3,3,3-trifluoro-2-hydroxypropyl)pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-(3,3,3-trifluoro-2-hydroxypropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105056220 |
| Molecular Formula | C9H7Cl2F3N2O2 |
| Molecular Weight | 303.07 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 2,5-dichloro-N-(3,3,3-trifluoro-2-hydroxypropyl)pyridine-4-carboxamide |
| SMILES | O=C(NCC(O)C(F)(F)F)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C9H7Cl2F3N2O2/c10-5-2-15-7(11)1-4(5)8(18)16-3-6(17)9(12,13)14/h1-2,6,17H,3H2,(H,16,18) |
| InChIKey | LTKITBWRFRTKLL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.07 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|