C9H6ClF3N2O2 — CID 174879581
2-chloro-5-nitroso-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 174879581) has the molecular formula C9H6ClF3N2O2 and a molecular weight of 266.61 g/mol. Its IUPAC name is 2-chloro-5-nitroso-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-chloro-5-nitroso-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 174879581 |
| Molecular Formula | C9H6ClF3N2O2 |
| Molecular Weight | 266.61 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-chloro-5-nitroso-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=Nc1ccc(Cl)c(C(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H6ClF3N2O2/c10-7-2-1-5(15-17)3-6(7)8(16)14-4-9(11,12)13/h1-3H,4H2,(H,14,16) |
| InChIKey | HKKBSXFMPGAYJO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.61 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |