C19H9Cl3F8N2O2 — CID 140859650
2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(2,3,4,5,6-pentafluorophenyl)cyclopropanecarbonyl]amino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 140859650) has the molecular formula C19H9Cl3F8N2O2 and a molecular weight of 555.64 g/mol. Its IUPAC name is 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(2,3,4,5,6-pentafluorophenyl)cyclopropanecarbonyl]amino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(2,3,4,5,6-pentafluorophenyl)cyclopropanecarbonyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 140859650 |
| Molecular Formula | C19H9Cl3F8N2O2 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 553.96 |
| IUPAC Name | 2-chloro-5-[[(1R,3R)-2,2-dichloro-3-(2,3,4,5,6-pentafluorophenyl)cyclopropanecarbonyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1cc(NC(=O)[C@H]2[C@H](c3c(F)c(F)c(F)c(F)c3F)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C19H9Cl3F8N2O2/c20-7-2-1-5(3-6(7)16(33)31-4-18(28,29)30)32-17(34)10-9(19(10,21)22)8-11(23)13(25)15(27)14(26)12(8)24/h1-3,9-10H,4H2,(H,31,33)(H,32,34)/t9-,10+/m0/s1 |
| InChIKey | MZHZZMXRRUOLIO-VHSXEESVSA-N |
| XLogP | 5.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|