C19H12Br2Cl3F3N2O2 — CID 122621248
2-chloro-5-[[2,2-dichloro-3-(3,4-dibromophenyl)cyclopropanecarbonyl]amino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 122621248) has the molecular formula C19H12Br2Cl3F3N2O2 and a molecular weight of 623.48 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,4-dibromophenyl)cyclopropanecarbonyl]amino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,4-dibromophenyl)cyclopropanecarbonyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 122621248 |
| Molecular Formula | C19H12Br2Cl3F3N2O2 |
| Molecular Weight | 623.48 g/mol |
| Exact Mass | 619.83 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,4-dibromophenyl)cyclopropanecarbonyl]amino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1cc(NC(=O)C2C(c3ccc(Br)c(Br)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C19H12Br2Cl3F3N2O2/c20-11-3-1-8(5-12(11)21)14-15(19(14,23)24)17(31)29-9-2-4-13(22)10(6-9)16(30)28-7-18(25,26)27/h1-6,14-15H,7H2,(H,28,30)(H,29,31) |
| InChIKey | JFRTYLQKEPBPIO-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|