About 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide
3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 175833514) has the molecular formula C8H6ClF3N2O
and a molecular weight of 238.60 g/mol. Its IUPAC name is 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| PubChem CID | 175833514 |
| Molecular Formula | C8H6ClF3N2O |
| Molecular Weight | 238.60 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ncccc1Cl |
| InChI | InChI=1S/C8H6ClF3N2O/c9-5-2-1-3-13-6(5)7(15)14-4-8(10,11)12/h1-3H,4H2,(H,14,15) |
| InChIKey | ADZMEDMEYMMBHY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.60 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide?
The IUPAC name of 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (CID 175833514) is 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
What is the SMILES notation for 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide?
The canonical SMILES for 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide is O=C(NCC(F)(F)F)c1ncccc1Cl.
What is the InChIKey of 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide?
The InChIKey is ADZMEDMEYMMBHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClF3N2O/c9-5-2-1-3-13-6(5)7(15)14-4-8(10,11)12/h1-3H,4H2,(H,14,15).
What are the key properties of 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide?
3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide has a molecular weight of 238.60 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide is sourced from PubChem (CID 175833514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).