C9H6ClF5N2O — CID 175833498
3-chloro-N-(2,2,3,3,3-pentafluoropropyl)pyridine-2-carboxamide (PubChem CID 175833498) has the molecular formula C9H6ClF5N2O and a molecular weight of 288.60 g/mol. Its IUPAC name is 3-chloro-N-(2,2,3,3,3-pentafluoropropyl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-N-(2,2,3,3,3-pentafluoropropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175833498 |
| Molecular Formula | C9H6ClF5N2O |
| Molecular Weight | 288.60 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 3-chloro-N-(2,2,3,3,3-pentafluoropropyl)pyridine-2-carboxamide |
| SMILES | O=C(NCC(F)(F)C(F)(F)F)c1ncccc1Cl |
| InChI | InChI=1S/C9H6ClF5N2O/c10-5-2-1-3-16-6(5)7(18)17-4-8(11,12)9(13,14)15/h1-3H,4H2,(H,17,18) |
| InChIKey | PCKMSAWXDATXLH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.60 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|