C9H7ClF3NO — CID 103443231
1-(3-chloro-2-pyridinyl)-4,4,4-trifluorobutan-1-one (PubChem CID 103443231) has the molecular formula C9H7ClF3NO and a molecular weight of 237.61 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(3-chloro-2-pyridinyl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 103443231 |
| Molecular Formula | C9H7ClF3NO |
| Molecular Weight | 237.61 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(CCC(F)(F)F)c1ncccc1Cl |
| InChI | InChI=1S/C9H7ClF3NO/c10-6-2-1-5-14-8(6)7(15)3-4-9(11,12)13/h1-2,5H,3-4H2 |
| InChIKey | ROWPHUBEVIRTAT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |