C15H11ClFNO2 — CID 90371133
1-(3-chloro-2-pyridinyl)-4-(3-fluorophenyl)butane-1,4-dione (PubChem CID 90371133) has the molecular formula C15H11ClFNO2 and a molecular weight of 291.71 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-4-(3-fluorophenyl)butane-1,4-dione.
| Compound Name | 1-(3-chloro-2-pyridinyl)-4-(3-fluorophenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 90371133 |
| Molecular Formula | C15H11ClFNO2 |
| Molecular Weight | 291.71 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-4-(3-fluorophenyl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ncccc1Cl)c1cccc(F)c1 |
| InChI | InChI=1S/C15H11ClFNO2/c16-12-5-2-8-18-15(12)14(20)7-6-13(19)10-3-1-4-11(17)9-10/h1-5,8-9H,6-7H2 |
| InChIKey | LUIWLAXIMMBTIA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.71 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |