C11H9Cl2F3O — CID 64567976
1-(2,6-dichlorophenyl)-5,5,5-trifluoropentan-2-one (PubChem CID 64567976) has the molecular formula C11H9Cl2F3O and a molecular weight of 285.09 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5,5,5-trifluoropentan-2-one.
| Compound Name | 1-(2,6-dichlorophenyl)-5,5,5-trifluoropentan-2-one |
|---|---|
| PubChem CID | 64567976 |
| Molecular Formula | C11H9Cl2F3O |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-5,5,5-trifluoropentan-2-one |
| SMILES | O=C(CCC(F)(F)F)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H9Cl2F3O/c12-9-2-1-3-10(13)8(9)6-7(17)4-5-11(14,15)16/h1-3H,4-6H2 |
| InChIKey | XJDFYTZZUPYVEX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |