sodium 2-(2,6-dichlorophenyl)acetate

C8H5Cl2NaO2 — CID 153409108

IUPACsodium 2-(2,6-dichlorophenyl)acetate
SMILESO=C([O-])Cc1c(Cl)cccc1Cl.[Na+]
InChIInChI=1S/C8H6Cl2O2.Na/c9-6-2-1-3-7(10)5(6)4-8(11)12;/h1-3H,4H2,(H,11,12);/q;+1/p-1
InChIKeyZQIHVYYBAVPKQQ-UHFFFAOYSA-M
MW227.02 g/mol
LogP-1.71
Rot. Bonds2

About sodium 2-(2,6-dichlorophenyl)acetate

sodium 2-(2,6-dichlorophenyl)acetate (PubChem CID 153409108) has the molecular formula C8H5Cl2NaO2 and a molecular weight of 227.02 g/mol. Its IUPAC name is sodium 2-(2,6-dichlorophenyl)acetate.

Molecular Properties

Compound Namesodium 2-(2,6-dichlorophenyl)acetate
PubChem CID153409108
Molecular FormulaC8H5Cl2NaO2
Molecular Weight227.02 g/mol
Exact Mass225.96
IUPAC Namesodium 2-(2,6-dichlorophenyl)acetate
SMILESO=C([O-])Cc1c(Cl)cccc1Cl.[Na+]
InChIInChI=1S/C8H6Cl2O2.Na/c9-6-2-1-3-7(10)5(6)4-8(11)12;/h1-3H,4H2,(H,11,12);/q;+1/p-1
InChIKeyZQIHVYYBAVPKQQ-UHFFFAOYSA-M
XLogP-1.71
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.02
LogP ≤ 5-1.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze sodium 2-(2,6-dichlorophenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-(2,6-dichlorophenyl)acetate?
The IUPAC name of sodium 2-(2,6-dichlorophenyl)acetate (CID 153409108) is sodium 2-(2,6-dichlorophenyl)acetate.
What is the SMILES notation for sodium 2-(2,6-dichlorophenyl)acetate?
The canonical SMILES for sodium 2-(2,6-dichlorophenyl)acetate is O=C([O-])Cc1c(Cl)cccc1Cl.[Na+].
What is the InChIKey of sodium 2-(2,6-dichlorophenyl)acetate?
The InChIKey is ZQIHVYYBAVPKQQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6Cl2O2.Na/c9-6-2-1-3-7(10)5(6)4-8(11)12;/h1-3H,4H2,(H,11,12);/q;+1/p-1.
What are the key properties of sodium 2-(2,6-dichlorophenyl)acetate?
sodium 2-(2,6-dichlorophenyl)acetate has a molecular weight of 227.02 g/mol, XLogP of -1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(2,6-dichlorophenyl)acetate is sourced from PubChem (CID 153409108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).