C8H5Cl2NaO2 — CID 153409108
sodium 2-(2,6-dichlorophenyl)acetate (PubChem CID 153409108) has the molecular formula C8H5Cl2NaO2 and a molecular weight of 227.02 g/mol. Its IUPAC name is sodium 2-(2,6-dichlorophenyl)acetate.
| Compound Name | sodium 2-(2,6-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 153409108 |
| Molecular Formula | C8H5Cl2NaO2 |
| Molecular Weight | 227.02 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | sodium 2-(2,6-dichlorophenyl)acetate |
| SMILES | O=C([O-])Cc1c(Cl)cccc1Cl.[Na+] |
| InChI | InChI=1S/C8H6Cl2O2.Na/c9-6-2-1-3-7(10)5(6)4-8(11)12;/h1-3H,4H2,(H,11,12);/q;+1/p-1 |
| InChIKey | ZQIHVYYBAVPKQQ-UHFFFAOYSA-M |
| XLogP | -1.71 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.02 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |