C14H10Cl2NO4S- — CID 7042035
2-[4-[(2,6-dichlorophenyl)sulfonylamino]phenyl]acetate (PubChem CID 7042035) has the molecular formula C14H10Cl2NO4S- and a molecular weight of 359.21 g/mol. Its IUPAC name is 2-[4-[(2,6-dichlorophenyl)sulfonylamino]phenyl]acetate.
| Compound Name | 2-[4-[(2,6-dichlorophenyl)sulfonylamino]phenyl]acetate |
|---|---|
| PubChem CID | 7042035 |
| Molecular Formula | C14H10Cl2NO4S- |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 2-[4-[(2,6-dichlorophenyl)sulfonylamino]phenyl]acetate |
| SMILES | O=C([O-])Cc1ccc(NS(=O)(=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C14H11Cl2NO4S/c15-11-2-1-3-12(16)14(11)22(20,21)17-10-6-4-9(5-7-10)8-13(18)19/h1-7,17H,8H2,(H,18,19)/p-1 |
| InChIKey | BNGNFYNUGMICCS-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |