C15H12ClN3O7S — CID 167961327
3-[4-[(2-chloro-6-nitrophenyl)sulfonylamino]anilino]-3-oxopropanoic acid (PubChem CID 167961327) has the molecular formula C15H12ClN3O7S and a molecular weight of 413.80 g/mol. Its IUPAC name is 3-[4-[(2-chloro-6-nitrophenyl)sulfonylamino]anilino]-3-oxopropanoic acid.
| Compound Name | 3-[4-[(2-chloro-6-nitrophenyl)sulfonylamino]anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 167961327 |
| Molecular Formula | C15H12ClN3O7S |
| Molecular Weight | 413.80 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | 3-[4-[(2-chloro-6-nitrophenyl)sulfonylamino]anilino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)Nc1ccc(NS(=O)(=O)c2c(Cl)cccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12ClN3O7S/c16-11-2-1-3-12(19(23)24)15(11)27(25,26)18-10-6-4-9(5-7-10)17-13(20)8-14(21)22/h1-7,18H,8H2,(H,17,20)(H,21,22) |
| InChIKey | IHCKVPYGFAHICH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 155.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.80 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|