C14H12ClN3O5S — CID 127031219
N-(4-chlorophenyl)-2-[(2-nitrophenyl)sulfonylamino]acetamide (PubChem CID 127031219) has the molecular formula C14H12ClN3O5S and a molecular weight of 369.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(2-nitrophenyl)sulfonylamino]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(2-nitrophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 127031219 |
| Molecular Formula | C14H12ClN3O5S |
| Molecular Weight | 369.79 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(2-nitrophenyl)sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1[N+](=O)[O-])Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12ClN3O5S/c15-10-5-7-11(8-6-10)17-14(19)9-16-24(22,23)13-4-2-1-3-12(13)18(20)21/h1-8,16H,9H2,(H,17,19) |
| InChIKey | IOUORDDJHVAUKI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|