C8H10N4O5S — CID 135248443
N'-hydroxy-2-[(2-nitrophenyl)sulfonylamino]ethanimidamide (PubChem CID 135248443) has the molecular formula C8H10N4O5S and a molecular weight of 274.26 g/mol. Its IUPAC name is N'-hydroxy-2-[(2-nitrophenyl)sulfonylamino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[(2-nitrophenyl)sulfonylamino]ethanimidamide |
|---|---|
| PubChem CID | 135248443 |
| Molecular Formula | C8H10N4O5S |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N'-hydroxy-2-[(2-nitrophenyl)sulfonylamino]ethanimidamide |
| SMILES | N/C(CNS(=O)(=O)c1ccccc1[N+](=O)[O-])=N\O |
| InChI | InChI=1S/C8H10N4O5S/c9-8(11-13)5-10-18(16,17)7-4-2-1-3-6(7)12(14)15/h1-4,10,13H,5H2,(H2,9,11) |
| InChIKey | FNWIBMFFKKHXKB-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|