C13H16Cl2O3S — CID 65097700
1-(2,6-dichlorophenyl)-5-ethylsulfonylpentan-2-one (PubChem CID 65097700) has the molecular formula C13H16Cl2O3S and a molecular weight of 323.24 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5-ethylsulfonylpentan-2-one.
| Compound Name | 1-(2,6-dichlorophenyl)-5-ethylsulfonylpentan-2-one |
|---|---|
| PubChem CID | 65097700 |
| Molecular Formula | C13H16Cl2O3S |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-5-ethylsulfonylpentan-2-one |
| SMILES | CCS(=O)(=O)CCCC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H16Cl2O3S/c1-2-19(17,18)8-4-5-10(16)9-11-12(14)6-3-7-13(11)15/h3,6-7H,2,4-5,8-9H2,1H3 |
| InChIKey | MDCXPYXGMURMFJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |