C12H14F3NO — CID 82729556
1-(3-ethyl-2-pyridinyl)-5,5,5-trifluoropentan-1-one (PubChem CID 82729556) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is 1-(3-ethyl-2-pyridinyl)-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-(3-ethyl-2-pyridinyl)-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 82729556 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-(3-ethyl-2-pyridinyl)-5,5,5-trifluoropentan-1-one |
| SMILES | CCc1cccnc1C(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C12H14F3NO/c1-2-9-5-4-8-16-11(9)10(17)6-3-7-12(13,14)15/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | OLVBHNJETUXMQD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |