C14H21NO — CID 82730843
1-(3-ethyl-2-pyridinyl)-4,4-dimethylpentan-1-one (PubChem CID 82730843) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-(3-ethyl-2-pyridinyl)-4,4-dimethylpentan-1-one.
| Compound Name | 1-(3-ethyl-2-pyridinyl)-4,4-dimethylpentan-1-one |
|---|---|
| PubChem CID | 82730843 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1-(3-ethyl-2-pyridinyl)-4,4-dimethylpentan-1-one |
| SMILES | CCc1cccnc1C(=O)CCC(C)(C)C |
| InChI | InChI=1S/C14H21NO/c1-5-11-7-6-10-15-13(11)12(16)8-9-14(2,3)4/h6-7,10H,5,8-9H2,1-4H3 |
| InChIKey | UFQHWBHKYITNEJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |