About diazanium;3-chloropyridine-2-carboxylate;ethanolate
diazanium;3-chloropyridine-2-carboxylate;ethanolate (PubChem CID 141333472) has the molecular formula C8H16ClN3O3
and a molecular weight of 237.69 g/mol. Its IUPAC name is diazanium;3-chloropyridine-2-carboxylate;ethanolate.
Molecular Properties
| Compound Name | diazanium;3-chloropyridine-2-carboxylate;ethanolate |
| PubChem CID | 141333472 |
| Molecular Formula | C8H16ClN3O3 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | diazanium;3-chloropyridine-2-carboxylate;ethanolate |
| SMILES | CC[O-].O=C([O-])c1ncccc1Cl.[NH4+].[NH4+] |
| InChI | InChI=1S/C6H4ClNO2.C2H5O.2H3N/c7-4-2-1-3-8-5(4)6(9)10;1-2-3;;/h1-3H,(H,9,10);2H2,1H3;2*1H3/q;-1;;/p+1 |
| InChIKey | UZKHZKIXPJCGRJ-UHFFFAOYSA-O |
| XLogP | 0.22 |
| TPSA | 149.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze diazanium;3-chloropyridine-2-carboxylate;ethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;3-chloropyridine-2-carboxylate;ethanolate?
The IUPAC name of diazanium;3-chloropyridine-2-carboxylate;ethanolate (CID 141333472) is diazanium;3-chloropyridine-2-carboxylate;ethanolate.
What is the SMILES notation for diazanium;3-chloropyridine-2-carboxylate;ethanolate?
The canonical SMILES for diazanium;3-chloropyridine-2-carboxylate;ethanolate is CC[O-].O=C([O-])c1ncccc1Cl.[NH4+].[NH4+].
What is the InChIKey of diazanium;3-chloropyridine-2-carboxylate;ethanolate?
The InChIKey is UZKHZKIXPJCGRJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H4ClNO2.C2H5O.2H3N/c7-4-2-1-3-8-5(4)6(9)10;1-2-3;;/h1-3H,(H,9,10);2H2,1H3;2*1H3/q;-1;;/p+1.
What are the key properties of diazanium;3-chloropyridine-2-carboxylate;ethanolate?
diazanium;3-chloropyridine-2-carboxylate;ethanolate has a molecular weight of 237.69 g/mol, XLogP of 0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;3-chloropyridine-2-carboxylate;ethanolate is sourced from PubChem (CID 141333472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).