potassium 3-methoxypyridine-2-carboxylate

C7H6KNO3 — CID 159434407

IUPACpotassium 3-methoxypyridine-2-carboxylate
SMILESCOc1cccnc1C(=O)[O-].[K+]
InChIInChI=1S/C7H7NO3.K/c1-11-5-3-2-4-8-6(5)7(9)10;/h2-4H,1H3,(H,9,10);/q;+1/p-1
InChIKeyLRJVWXFWYAMLRO-UHFFFAOYSA-M
MW191.23 g/mol
LogP-3.54
Rot. Bonds2

About potassium 3-methoxypyridine-2-carboxylate

potassium 3-methoxypyridine-2-carboxylate (PubChem CID 159434407) has the molecular formula C7H6KNO3 and a molecular weight of 191.23 g/mol. Its IUPAC name is potassium 3-methoxypyridine-2-carboxylate.

Molecular Properties

Compound Namepotassium 3-methoxypyridine-2-carboxylate
PubChem CID159434407
Molecular FormulaC7H6KNO3
Molecular Weight191.23 g/mol
Exact Mass191.00
IUPAC Namepotassium 3-methoxypyridine-2-carboxylate
SMILESCOc1cccnc1C(=O)[O-].[K+]
InChIInChI=1S/C7H7NO3.K/c1-11-5-3-2-4-8-6(5)7(9)10;/h2-4H,1H3,(H,9,10);/q;+1/p-1
InChIKeyLRJVWXFWYAMLRO-UHFFFAOYSA-M
XLogP-3.54
TPSA62.25 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.23
LogP ≤ 5-3.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze potassium 3-methoxypyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 3-methoxypyridine-2-carboxylate?
The IUPAC name of potassium 3-methoxypyridine-2-carboxylate (CID 159434407) is potassium 3-methoxypyridine-2-carboxylate.
What is the SMILES notation for potassium 3-methoxypyridine-2-carboxylate?
The canonical SMILES for potassium 3-methoxypyridine-2-carboxylate is COc1cccnc1C(=O)[O-].[K+].
What is the InChIKey of potassium 3-methoxypyridine-2-carboxylate?
The InChIKey is LRJVWXFWYAMLRO-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7NO3.K/c1-11-5-3-2-4-8-6(5)7(9)10;/h2-4H,1H3,(H,9,10);/q;+1/p-1.
What are the key properties of potassium 3-methoxypyridine-2-carboxylate?
potassium 3-methoxypyridine-2-carboxylate has a molecular weight of 191.23 g/mol, XLogP of -3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-methoxypyridine-2-carboxylate is sourced from PubChem (CID 159434407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).